C22H26O3 — CID 12965724
[4-[1-(4-methoxyphenyl)but-3-enyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 12965724) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is [4-[1-(4-methoxyphenyl)but-3-enyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[1-(4-methoxyphenyl)but-3-enyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 12965724 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | [4-[1-(4-methoxyphenyl)but-3-enyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | C=CCC(c1ccc(OC)cc1)c1ccc(OC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H26O3/c1-6-7-20(16-8-12-18(24-5)13-9-16)17-10-14-19(15-11-17)25-21(23)22(2,3)4/h6,8-15,20H,1,7H2,2-5H3 |
| InChIKey | WERQFGDCSZSBGT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|