C21H26O2 — CID 73413074
[4-[(1R)-1-phenylbutyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 73413074) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is [4-[(1R)-1-phenylbutyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[(1R)-1-phenylbutyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 73413074 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | [4-[(1R)-1-phenylbutyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CCC[C@H](c1ccccc1)c1ccc(OC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H26O2/c1-5-9-19(16-10-7-6-8-11-16)17-12-14-18(15-13-17)23-20(22)21(2,3)4/h6-8,10-15,19H,5,9H2,1-4H3/t19-/m1/s1 |
| InChIKey | FQAODAJJEBAZRO-LJQANCHMSA-N |
| XLogP | 5.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|