C31H38O3 — CID 54232468
[4-[2-(4-hydroxyphenyl)-6-phenyloctan-4-yl]phenyl] 2,2-dimethylpropanoate (PubChem CID 54232468) has the molecular formula C31H38O3 and a molecular weight of 458.64 g/mol. Its IUPAC name is [4-[2-(4-hydroxyphenyl)-6-phenyloctan-4-yl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[2-(4-hydroxyphenyl)-6-phenyloctan-4-yl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 54232468 |
| Molecular Formula | C31H38O3 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | [4-[2-(4-hydroxyphenyl)-6-phenyloctan-4-yl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CCC(CC(CC(C)c1ccc(O)cc1)c1ccc(OC(=O)C(C)(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H38O3/c1-6-23(25-10-8-7-9-11-25)21-27(20-22(2)24-12-16-28(32)17-13-24)26-14-18-29(19-15-26)34-30(33)31(3,4)5/h7-19,22-23,27,32H,6,20-21H2,1-5H3 |
| InChIKey | VZESQQOHGOXCGE-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|