C28H38O6 — CID 18730244
tert-butyl [4-[1-ethyl-3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]butyl]phenyl] carbonate (PubChem CID 18730244) has the molecular formula C28H38O6 and a molecular weight of 470.61 g/mol. Its IUPAC name is tert-butyl [4-[1-ethyl-3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]butyl]phenyl] carbonate.
| Compound Name | tert-butyl [4-[1-ethyl-3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]butyl]phenyl] carbonate |
|---|---|
| PubChem CID | 18730244 |
| Molecular Formula | C28H38O6 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | tert-butyl [4-[1-ethyl-3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]butyl]phenyl] carbonate |
| SMILES | CCC(CC(C)c1ccc(OC(=O)OC(C)(C)C)cc1)c1ccc(OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C28H38O6/c1-9-20(22-12-16-24(17-13-22)32-26(30)34-28(6,7)8)18-19(2)21-10-14-23(15-11-21)31-25(29)33-27(3,4)5/h10-17,19-20H,9,18H2,1-8H3 |
| InChIKey | NHEGJPSLVOSBAT-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|