C40H54O10 — CID 161066558
[4-[1,1-bis[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]ethyl]phenyl] tert-butyl carbonate;2-methoxybutane (PubChem CID 161066558) has the molecular formula C40H54O10 and a molecular weight of 694.86 g/mol. Its IUPAC name is [4-[1,1-bis[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]ethyl]phenyl] tert-butyl carbonate;2-methoxybutane.
| Compound Name | [4-[1,1-bis[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]ethyl]phenyl] tert-butyl carbonate;2-methoxybutane |
|---|---|
| PubChem CID | 161066558 |
| Molecular Formula | C40H54O10 |
| Molecular Weight | 694.86 g/mol |
| Exact Mass | 694.37 |
| IUPAC Name | [4-[1,1-bis[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]ethyl]phenyl] tert-butyl carbonate;2-methoxybutane |
| SMILES | CC(C)(C)OC(=O)Oc1ccc(C(C)(c2ccc(OC(=O)OC(C)(C)C)cc2)c2ccc(OC(=O)OC(C)(C)C)cc2)cc1.CCC(C)OC |
| InChI | InChI=1S/C35H42O9.C5H12O/c1-32(2,3)42-29(36)39-26-17-11-23(12-18-26)35(10,24-13-19-27(20-14-24)40-30(37)43-33(4,5)6)25-15-21-28(22-16-25)41-31(38)44-34(7,8)9;1-4-5(2)6-3/h11-22H,1-10H3;5H,4H2,1-3H3 |
| InChIKey | UECFSBYZIVQLSN-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.86 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|