C21H26O3 — CID 20610670
tert-butyl [4-[2-(4-methylphenyl)propan-2-yl]phenyl] carbonate (PubChem CID 20610670) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is tert-butyl [4-[2-(4-methylphenyl)propan-2-yl]phenyl] carbonate.
| Compound Name | tert-butyl [4-[2-(4-methylphenyl)propan-2-yl]phenyl] carbonate |
|---|---|
| PubChem CID | 20610670 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | tert-butyl [4-[2-(4-methylphenyl)propan-2-yl]phenyl] carbonate |
| SMILES | Cc1ccc(C(C)(C)c2ccc(OC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H26O3/c1-15-7-9-16(10-8-15)21(5,6)17-11-13-18(14-12-17)23-19(22)24-20(2,3)4/h7-14H,1-6H3 |
| InChIKey | YMYOJABVZVABGN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|