C35H40O5Si — CID 162487614
[4-[2-[4-[dimethyl-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]silyl]oxyphenyl]propan-2-yl]phenyl] methyl carbonate (PubChem CID 162487614) has the molecular formula C35H40O5Si and a molecular weight of 568.79 g/mol. Its IUPAC name is [4-[2-[4-[dimethyl-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]silyl]oxyphenyl]propan-2-yl]phenyl] methyl carbonate.
| Compound Name | [4-[2-[4-[dimethyl-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]silyl]oxyphenyl]propan-2-yl]phenyl] methyl carbonate |
|---|---|
| PubChem CID | 162487614 |
| Molecular Formula | C35H40O5Si |
| Molecular Weight | 568.79 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | [4-[2-[4-[dimethyl-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]silyl]oxyphenyl]propan-2-yl]phenyl] methyl carbonate |
| SMILES | COC(=O)Oc1ccc(C(C)(C)c2ccc(O[Si](C)(C)Oc3ccc(C(C)(C)c4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H40O5Si/c1-25-9-11-26(12-10-25)34(2,3)28-15-21-31(22-16-28)39-41(7,8)40-32-23-17-29(18-24-32)35(4,5)27-13-19-30(20-14-27)38-33(36)37-6/h9-24H,1-8H3 |
| InChIKey | SLAMYCVNSSPJEK-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.79 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|