About 4-(4-hydroxyphenyl)phenol;methyl [4-(4-methylphenyl)phenyl] carbonate
4-(4-hydroxyphenyl)phenol;methyl [4-(4-methylphenyl)phenyl] carbonate (PubChem CID 161066269) has the molecular formula C27H24O5
and a molecular weight of 428.48 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)phenol;methyl [4-(4-methylphenyl)phenyl] carbonate.
Molecular Properties
| Compound Name | 4-(4-hydroxyphenyl)phenol;methyl [4-(4-methylphenyl)phenyl] carbonate |
| PubChem CID | 161066269 |
| Molecular Formula | C27H24O5 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 4-(4-hydroxyphenyl)phenol;methyl [4-(4-methylphenyl)phenyl] carbonate |
| SMILES | COC(=O)Oc1ccc(-c2ccc(C)cc2)cc1.Oc1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C15H14O3.C12H10O2/c1-11-3-5-12(6-4-11)13-7-9-14(10-8-13)18-15(16)17-2;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h3-10H,1-2H3;1-8,13-14H |
| InChIKey | UEBGTVHIVJCAIK-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-hydroxyphenyl)phenol;methyl [4-(4-methylphenyl)phenyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-hydroxyphenyl)phenol;methyl [4-(4-methylphenyl)phenyl] carbonate?
The IUPAC name of 4-(4-hydroxyphenyl)phenol;methyl [4-(4-methylphenyl)phenyl] carbonate (CID 161066269) is 4-(4-hydroxyphenyl)phenol;methyl [4-(4-methylphenyl)phenyl] carbonate.
What is the SMILES notation for 4-(4-hydroxyphenyl)phenol;methyl [4-(4-methylphenyl)phenyl] carbonate?
The canonical SMILES for 4-(4-hydroxyphenyl)phenol;methyl [4-(4-methylphenyl)phenyl] carbonate is COC(=O)Oc1ccc(-c2ccc(C)cc2)cc1.Oc1ccc(-c2ccc(O)cc2)cc1.
What is the InChIKey of 4-(4-hydroxyphenyl)phenol;methyl [4-(4-methylphenyl)phenyl] carbonate?
The InChIKey is UEBGTVHIVJCAIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O3.C12H10O2/c1-11-3-5-12(6-4-11)13-7-9-14(10-8-13)18-15(16)17-2;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h3-10H,1-2H3;1-8,13-14H.
What are the key properties of 4-(4-hydroxyphenyl)phenol;methyl [4-(4-methylphenyl)phenyl] carbonate?
4-(4-hydroxyphenyl)phenol;methyl [4-(4-methylphenyl)phenyl] carbonate has a molecular weight of 428.48 g/mol, XLogP of 6.57, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hydroxyphenyl)phenol;methyl [4-(4-methylphenyl)phenyl] carbonate is sourced from PubChem (CID 161066269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).