C35H40O5Si — CID 170514831
[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] [4-[2-(4-trimethylsilyloxyphenyl)propan-2-yl]phenyl] carbonate (PubChem CID 170514831) has the molecular formula C35H40O5Si and a molecular weight of 568.79 g/mol. Its IUPAC name is [4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] [4-[2-(4-trimethylsilyloxyphenyl)propan-2-yl]phenyl] carbonate.
| Compound Name | [4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] [4-[2-(4-trimethylsilyloxyphenyl)propan-2-yl]phenyl] carbonate |
|---|---|
| PubChem CID | 170514831 |
| Molecular Formula | C35H40O5Si |
| Molecular Weight | 568.79 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | [4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] [4-[2-(4-trimethylsilyloxyphenyl)propan-2-yl]phenyl] carbonate |
| SMILES | COc1ccc(C(C)(C)c2ccc(OC(=O)Oc3ccc(C(C)(C)c4ccc(O[Si](C)(C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H40O5Si/c1-34(2,25-9-17-29(37-5)18-10-25)26-11-19-30(20-12-26)38-33(36)39-31-21-13-27(14-22-31)35(3,4)28-15-23-32(24-16-28)40-41(6,7)8/h9-24H,1-8H3 |
| InChIKey | FYKNSSWESHYTAN-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.79 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|