C31H30O4 — CID 58351625
[4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl] [4-(2-phenylpropan-2-yl)phenyl] carbonate (PubChem CID 58351625) has the molecular formula C31H30O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is [4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl] [4-(2-phenylpropan-2-yl)phenyl] carbonate.
| Compound Name | [4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl] [4-(2-phenylpropan-2-yl)phenyl] carbonate |
|---|---|
| PubChem CID | 58351625 |
| Molecular Formula | C31H30O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | [4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl] [4-(2-phenylpropan-2-yl)phenyl] carbonate |
| SMILES | CC(C)(c1ccccc1)c1ccc(OC(=O)Oc2ccc(C(C)(C)c3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H30O4/c1-30(2,22-8-6-5-7-9-22)24-12-18-27(19-13-24)34-29(33)35-28-20-14-25(15-21-28)31(3,4)23-10-16-26(32)17-11-23/h5-21,32H,1-4H3 |
| InChIKey | PUAYKYRAVWNRIN-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|