C52H42O10 — CID 102500670
bis[4-[2-(4-phenoxycarbonyloxyphenyl)propan-2-yl]phenyl] benzene-1,4-dicarboxylate (PubChem CID 102500670) has the molecular formula C52H42O10 and a molecular weight of 826.90 g/mol. Its IUPAC name is bis[4-[2-(4-phenoxycarbonyloxyphenyl)propan-2-yl]phenyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[4-[2-(4-phenoxycarbonyloxyphenyl)propan-2-yl]phenyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 102500670 |
| Molecular Formula | C52H42O10 |
| Molecular Weight | 826.90 g/mol |
| Exact Mass | 826.28 |
| IUPAC Name | bis[4-[2-(4-phenoxycarbonyloxyphenyl)propan-2-yl]phenyl] benzene-1,4-dicarboxylate |
| SMILES | CC(C)(c1ccc(OC(=O)Oc2ccccc2)cc1)c1ccc(OC(=O)c2ccc(C(=O)Oc3ccc(C(C)(C)c4ccc(OC(=O)Oc5ccccc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C52H42O10/c1-51(2,39-23-31-45(32-24-39)61-49(55)59-41-11-7-5-8-12-41)37-19-27-43(28-20-37)57-47(53)35-15-17-36(18-16-35)48(54)58-44-29-21-38(22-30-44)52(3,4)40-25-33-46(34-26-40)62-50(56)60-42-13-9-6-10-14-42/h5-34H,1-4H3 |
| InChIKey | AJBQWLNUATYLKR-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.90 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|