About methyl acetate;[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzoate
methyl acetate;[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzoate (PubChem CID 144741916) has the molecular formula C26H28O4
and a molecular weight of 404.51 g/mol. Its IUPAC name is methyl acetate;[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzoate.
Molecular Properties
| Compound Name | methyl acetate;[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzoate |
| PubChem CID | 144741916 |
| Molecular Formula | C26H28O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | methyl acetate;[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzoate |
| SMILES | COC(C)=O.Cc1ccc(C(C)(C)c2ccc(OC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H22O2.C3H6O2/c1-17-9-11-19(12-10-17)23(2,3)20-13-15-21(16-14-20)25-22(24)18-7-5-4-6-8-18;1-3(4)5-2/h4-16H,1-3H3;1-2H3 |
| InChIKey | VKMXGAUVPYYUTQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze methyl acetate;[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl acetate;[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzoate?
The IUPAC name of methyl acetate;[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzoate (CID 144741916) is methyl acetate;[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzoate.
What is the SMILES notation for methyl acetate;[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzoate?
The canonical SMILES for methyl acetate;[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzoate is COC(C)=O.Cc1ccc(C(C)(C)c2ccc(OC(=O)c3ccccc3)cc2)cc1.
What is the InChIKey of methyl acetate;[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzoate?
The InChIKey is VKMXGAUVPYYUTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22O2.C3H6O2/c1-17-9-11-19(12-10-17)23(2,3)20-13-15-21(16-14-20)25-22(24)18-7-5-4-6-8-18;1-3(4)5-2/h4-16H,1-3H3;1-2H3.
What are the key properties of methyl acetate;[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzoate?
methyl acetate;[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzoate has a molecular weight of 404.51 g/mol, XLogP of 5.72, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl acetate;[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzoate is sourced from PubChem (CID 144741916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).