C30H20F6O4 — CID 158568545
[4-[2-(4-benzoyloxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] 4-methylbenzoate (PubChem CID 158568545) has the molecular formula C30H20F6O4 and a molecular weight of 558.47 g/mol. Its IUPAC name is [4-[2-(4-benzoyloxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[2-(4-benzoyloxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 158568545 |
| Molecular Formula | C30H20F6O4 |
| Molecular Weight | 558.47 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | [4-[2-(4-benzoyloxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(C(c3ccc(OC(=O)c4ccccc4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H20F6O4/c1-19-7-9-21(10-8-19)27(38)40-25-17-13-23(14-18-25)28(29(31,32)33,30(34,35)36)22-11-15-24(16-12-22)39-26(37)20-5-3-2-4-6-20/h2-18H,1H3 |
| InChIKey | HRUFDCPNDZWILM-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.47 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|