C25H16F12 — CID 143291553
1-[1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)phenyl]propan-2-yl]-4-methylbenzene (PubChem CID 143291553) has the molecular formula C25H16F12 and a molecular weight of 544.38 g/mol. Its IUPAC name is 1-[1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)phenyl]propan-2-yl]-4-methylbenzene.
| Compound Name | 1-[1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)phenyl]propan-2-yl]-4-methylbenzene |
|---|---|
| PubChem CID | 143291553 |
| Molecular Formula | C25H16F12 |
| Molecular Weight | 544.38 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | 1-[1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)phenyl]propan-2-yl]-4-methylbenzene |
| SMILES | Cc1ccc(C(c2ccc(C(c3ccccc3)(C(F)(F)F)C(F)(F)F)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H16F12/c1-15-7-9-17(10-8-15)21(24(32,33)34,25(35,36)37)19-13-11-18(12-14-19)20(22(26,27)28,23(29,30)31)16-5-3-2-4-6-16/h2-14H,1H3 |
| InChIKey | BVUJRRDDJSAXPL-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.38 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |