C39H28F6N2 — CID 129147379
4-[1,1,1,3,3,3-hexafluoro-2-[4-(N-phenylanilino)phenyl]propan-2-yl]-N,N-diphenylaniline (PubChem CID 129147379) has the molecular formula C39H28F6N2 and a molecular weight of 638.66 g/mol. Its IUPAC name is 4-[1,1,1,3,3,3-hexafluoro-2-[4-(N-phenylanilino)phenyl]propan-2-yl]-N,N-diphenylaniline.
| Compound Name | 4-[1,1,1,3,3,3-hexafluoro-2-[4-(N-phenylanilino)phenyl]propan-2-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 129147379 |
| Molecular Formula | C39H28F6N2 |
| Molecular Weight | 638.66 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | 4-[1,1,1,3,3,3-hexafluoro-2-[4-(N-phenylanilino)phenyl]propan-2-yl]-N,N-diphenylaniline |
| SMILES | FC(F)(F)C(c1ccc(N(c2ccccc2)c2ccccc2)cc1)(c1ccc(N(c2ccccc2)c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C39H28F6N2/c40-38(41,42)37(39(43,44)45,29-21-25-35(26-22-29)46(31-13-5-1-6-14-31)32-15-7-2-8-16-32)30-23-27-36(28-24-30)47(33-17-9-3-10-18-33)34-19-11-4-12-20-34/h1-28H |
| InChIKey | QKJJFPCVHKPJCL-UHFFFAOYSA-N |
| XLogP | 12.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.66 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |