C40H44N2 — CID 143918142
1-N,4-N-bis[4-(2-methylbutan-2-yl)phenyl]-1-N,4-N-diphenylbenzene-1,4-diamine (PubChem CID 143918142) has the molecular formula C40H44N2 and a molecular weight of 552.81 g/mol. Its IUPAC name is 1-N,4-N-bis[4-(2-methylbutan-2-yl)phenyl]-1-N,4-N-diphenylbenzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis[4-(2-methylbutan-2-yl)phenyl]-1-N,4-N-diphenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 143918142 |
| Molecular Formula | C40H44N2 |
| Molecular Weight | 552.81 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | 1-N,4-N-bis[4-(2-methylbutan-2-yl)phenyl]-1-N,4-N-diphenylbenzene-1,4-diamine |
| SMILES | CCC(C)(C)c1ccc(N(c2ccccc2)c2ccc(N(c3ccccc3)c3ccc(C(C)(C)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H44N2/c1-7-39(3,4)31-19-23-35(24-20-31)41(33-15-11-9-12-16-33)37-27-29-38(30-28-37)42(34-17-13-10-14-18-34)36-25-21-32(22-26-36)40(5,6)8-2/h9-30H,7-8H2,1-6H3 |
| InChIKey | AVQFDGCJPHLDDU-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.81 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |