C31H35N — CID 130269208
N-[2-[4-(2-methylbutan-2-yl)phenyl]butan-2-yl]-N-phenylnaphthalen-2-amine (PubChem CID 130269208) has the molecular formula C31H35N and a molecular weight of 421.63 g/mol. Its IUPAC name is N-[2-[4-(2-methylbutan-2-yl)phenyl]butan-2-yl]-N-phenylnaphthalen-2-amine.
| Compound Name | N-[2-[4-(2-methylbutan-2-yl)phenyl]butan-2-yl]-N-phenylnaphthalen-2-amine |
|---|---|
| PubChem CID | 130269208 |
| Molecular Formula | C31H35N |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | N-[2-[4-(2-methylbutan-2-yl)phenyl]butan-2-yl]-N-phenylnaphthalen-2-amine |
| SMILES | CCC(C)(C)c1ccc(C(C)(CC)N(c2ccccc2)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C31H35N/c1-6-30(3,4)26-18-20-27(21-19-26)31(5,7-2)32(28-15-9-8-10-16-28)29-22-17-24-13-11-12-14-25(24)23-29/h8-23H,6-7H2,1-5H3 |
| InChIKey | WBMBGSRDSCKYBC-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |