C33H39N — CID 118074809
N-[4-(2-methylbutan-2-yl)phenyl]-N-[4-(2-methylpentan-2-yl)phenyl]naphthalen-1-amine (PubChem CID 118074809) has the molecular formula C33H39N and a molecular weight of 449.68 g/mol. Its IUPAC name is N-[4-(2-methylbutan-2-yl)phenyl]-N-[4-(2-methylpentan-2-yl)phenyl]naphthalen-1-amine.
| Compound Name | N-[4-(2-methylbutan-2-yl)phenyl]-N-[4-(2-methylpentan-2-yl)phenyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 118074809 |
| Molecular Formula | C33H39N |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.31 |
| IUPAC Name | N-[4-(2-methylbutan-2-yl)phenyl]-N-[4-(2-methylpentan-2-yl)phenyl]naphthalen-1-amine |
| SMILES | CCCC(C)(C)c1ccc(N(c2ccc(C(C)(C)CC)cc2)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C33H39N/c1-7-24-33(5,6)27-18-22-29(23-19-27)34(28-20-16-26(17-21-28)32(3,4)8-2)31-15-11-13-25-12-9-10-14-30(25)31/h9-23H,7-8,24H2,1-6H3 |
| InChIKey | NUCOTHNDRBOYJR-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |