C30H41N — CID 142315173
N-(4-tert-butylphenyl)-3-methyl-N-[4-(2-methylbutan-2-yl)phenyl]aniline;ethane (PubChem CID 142315173) has the molecular formula C30H41N and a molecular weight of 415.67 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-3-methyl-N-[4-(2-methylbutan-2-yl)phenyl]aniline;ethane.
| Compound Name | N-(4-tert-butylphenyl)-3-methyl-N-[4-(2-methylbutan-2-yl)phenyl]aniline;ethane |
|---|---|
| PubChem CID | 142315173 |
| Molecular Formula | C30H41N |
| Molecular Weight | 415.67 g/mol |
| Exact Mass | 415.32 |
| IUPAC Name | N-(4-tert-butylphenyl)-3-methyl-N-[4-(2-methylbutan-2-yl)phenyl]aniline;ethane |
| SMILES | CC.CCC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C28H35N.C2H6/c1-8-28(6,7)23-14-18-25(19-15-23)29(26-11-9-10-21(2)20-26)24-16-12-22(13-17-24)27(3,4)5;1-2/h9-20H,8H2,1-7H3;1-2H3 |
| InChIKey | HSZLOMFUAHRTQD-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.67 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |