C20H27NO2S — CID 3672777
N-ethyl-4-(2-methylbutan-2-yl)-N-(3-methylphenyl)benzenesulfonamide (PubChem CID 3672777) has the molecular formula C20H27NO2S and a molecular weight of 345.51 g/mol. Its IUPAC name is N-ethyl-4-(2-methylbutan-2-yl)-N-(3-methylphenyl)benzenesulfonamide.
| Compound Name | N-ethyl-4-(2-methylbutan-2-yl)-N-(3-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3672777 |
| Molecular Formula | C20H27NO2S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-ethyl-4-(2-methylbutan-2-yl)-N-(3-methylphenyl)benzenesulfonamide |
| SMILES | CCN(c1cccc(C)c1)S(=O)(=O)c1ccc(C(C)(C)CC)cc1 |
| InChI | InChI=1S/C20H27NO2S/c1-6-20(4,5)17-11-13-19(14-12-17)24(22,23)21(7-2)18-10-8-9-16(3)15-18/h8-15H,6-7H2,1-5H3 |
| InChIKey | DCBCCAASRPPZFT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |