C17H20BrNO2S — CID 66485793
4-bromo-N-ethyl-2,5-dimethyl-N-(3-methylphenyl)benzenesulfonamide (PubChem CID 66485793) has the molecular formula C17H20BrNO2S and a molecular weight of 382.32 g/mol. Its IUPAC name is 4-bromo-N-ethyl-2,5-dimethyl-N-(3-methylphenyl)benzenesulfonamide.
| Compound Name | 4-bromo-N-ethyl-2,5-dimethyl-N-(3-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 66485793 |
| Molecular Formula | C17H20BrNO2S |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 4-bromo-N-ethyl-2,5-dimethyl-N-(3-methylphenyl)benzenesulfonamide |
| SMILES | CCN(c1cccc(C)c1)S(=O)(=O)c1cc(C)c(Br)cc1C |
| InChI | InChI=1S/C17H20BrNO2S/c1-5-19(15-8-6-7-12(2)9-15)22(20,21)17-11-13(3)16(18)10-14(17)4/h6-11H,5H2,1-4H3 |
| InChIKey | OHXKUCNFWOCLIW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |