C17H25N3O2S — CID 42283584
3-tert-butyl-N-ethyl-1-methyl-N-(3-methylphenyl)pyrazole-4-sulfonamide (PubChem CID 42283584) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is 3-tert-butyl-N-ethyl-1-methyl-N-(3-methylphenyl)pyrazole-4-sulfonamide.
| Compound Name | 3-tert-butyl-N-ethyl-1-methyl-N-(3-methylphenyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42283584 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 3-tert-butyl-N-ethyl-1-methyl-N-(3-methylphenyl)pyrazole-4-sulfonamide |
| SMILES | CCN(c1cccc(C)c1)S(=O)(=O)c1cn(C)nc1C(C)(C)C |
| InChI | InChI=1S/C17H25N3O2S/c1-7-20(14-10-8-9-13(2)11-14)23(21,22)15-12-19(6)18-16(15)17(3,4)5/h8-12H,7H2,1-6H3 |
| InChIKey | HNRXATBTTXUKCB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |