C14H27N3O2S — CID 42283422
3-tert-butyl-1-methyl-N,N-dipropylpyrazole-4-sulfonamide (PubChem CID 42283422) has the molecular formula C14H27N3O2S and a molecular weight of 301.46 g/mol. Its IUPAC name is 3-tert-butyl-1-methyl-N,N-dipropylpyrazole-4-sulfonamide.
| Compound Name | 3-tert-butyl-1-methyl-N,N-dipropylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42283422 |
| Molecular Formula | C14H27N3O2S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 3-tert-butyl-1-methyl-N,N-dipropylpyrazole-4-sulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1cn(C)nc1C(C)(C)C |
| InChI | InChI=1S/C14H27N3O2S/c1-7-9-17(10-8-2)20(18,19)12-11-16(6)15-13(12)14(3,4)5/h11H,7-10H2,1-6H3 |
| InChIKey | MGEMJKZZXBZYGA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |