C22H35N3O2S — CID 42284277
1-benzyl-N,N-dibutyl-3-tert-butylpyrazole-4-sulfonamide (PubChem CID 42284277) has the molecular formula C22H35N3O2S and a molecular weight of 405.61 g/mol. Its IUPAC name is 1-benzyl-N,N-dibutyl-3-tert-butylpyrazole-4-sulfonamide.
| Compound Name | 1-benzyl-N,N-dibutyl-3-tert-butylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42284277 |
| Molecular Formula | C22H35N3O2S |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 1-benzyl-N,N-dibutyl-3-tert-butylpyrazole-4-sulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1cn(Cc2ccccc2)nc1C(C)(C)C |
| InChI | InChI=1S/C22H35N3O2S/c1-6-8-15-25(16-9-7-2)28(26,27)20-18-24(23-21(20)22(3,4)5)17-19-13-11-10-12-14-19/h10-14,18H,6-9,15-17H2,1-5H3 |
| InChIKey | ISDNRXDAPMLLQM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |