C20H21Cl2N3O2S — CID 42284483
1-benzyl-3-tert-butyl-N-(2,5-dichlorophenyl)pyrazole-4-sulfonamide (PubChem CID 42284483) has the molecular formula C20H21Cl2N3O2S and a molecular weight of 438.38 g/mol. Its IUPAC name is 1-benzyl-3-tert-butyl-N-(2,5-dichlorophenyl)pyrazole-4-sulfonamide.
| Compound Name | 1-benzyl-3-tert-butyl-N-(2,5-dichlorophenyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42284483 |
| Molecular Formula | C20H21Cl2N3O2S |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 1-benzyl-3-tert-butyl-N-(2,5-dichlorophenyl)pyrazole-4-sulfonamide |
| SMILES | CC(C)(C)c1nn(Cc2ccccc2)cc1S(=O)(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H21Cl2N3O2S/c1-20(2,3)19-18(13-25(23-19)12-14-7-5-4-6-8-14)28(26,27)24-17-11-15(21)9-10-16(17)22/h4-11,13,24H,12H2,1-3H3 |
| InChIKey | NSPFASGCZVNHEV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |