C19H21N3O2S — CID 42283073
1-benzyl-N-(3,5-dimethylphenyl)-3-methylpyrazole-4-sulfonamide (PubChem CID 42283073) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 1-benzyl-N-(3,5-dimethylphenyl)-3-methylpyrazole-4-sulfonamide.
| Compound Name | 1-benzyl-N-(3,5-dimethylphenyl)-3-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42283073 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1-benzyl-N-(3,5-dimethylphenyl)-3-methylpyrazole-4-sulfonamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2cn(Cc3ccccc3)nc2C)c1 |
| InChI | InChI=1S/C19H21N3O2S/c1-14-9-15(2)11-18(10-14)21-25(23,24)19-13-22(20-16(19)3)12-17-7-5-4-6-8-17/h4-11,13,21H,12H2,1-3H3 |
| InChIKey | JXFGOSXUEVKSLU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |