C19H20FN3O2S — CID 42283116
1-benzyl-N-[2-(4-fluorophenyl)ethyl]-3-methylpyrazole-4-sulfonamide (PubChem CID 42283116) has the molecular formula C19H20FN3O2S and a molecular weight of 373.45 g/mol. Its IUPAC name is 1-benzyl-N-[2-(4-fluorophenyl)ethyl]-3-methylpyrazole-4-sulfonamide.
| Compound Name | 1-benzyl-N-[2-(4-fluorophenyl)ethyl]-3-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42283116 |
| Molecular Formula | C19H20FN3O2S |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-benzyl-N-[2-(4-fluorophenyl)ethyl]-3-methylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(Cc2ccccc2)cc1S(=O)(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FN3O2S/c1-15-19(14-23(22-15)13-17-5-3-2-4-6-17)26(24,25)21-12-11-16-7-9-18(20)10-8-16/h2-10,14,21H,11-13H2,1H3 |
| InChIKey | ZCLKPYDKKRGFLC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |