C12H14FN3O2S — CID 19584272
N-[(4-fluorophenyl)methyl]-1,3-dimethylpyrazole-4-sulfonamide (PubChem CID 19584272) has the molecular formula C12H14FN3O2S and a molecular weight of 283.33 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-1,3-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-1,3-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 19584272 |
| Molecular Formula | C12H14FN3O2S |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-1,3-dimethylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)cc1S(=O)(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C12H14FN3O2S/c1-9-12(8-16(2)15-9)19(17,18)14-7-10-3-5-11(13)6-4-10/h3-6,8,14H,7H2,1-2H3 |
| InChIKey | DNYMMKXOMLCTFK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |