C13H25N3O2S — CID 19681357
1,3-dimethyl-N-octylpyrazole-4-sulfonamide (PubChem CID 19681357) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is 1,3-dimethyl-N-octylpyrazole-4-sulfonamide.
| Compound Name | 1,3-dimethyl-N-octylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 19681357 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 1,3-dimethyl-N-octylpyrazole-4-sulfonamide |
| SMILES | CCCCCCCCNS(=O)(=O)c1cn(C)nc1C |
| InChI | InChI=1S/C13H25N3O2S/c1-4-5-6-7-8-9-10-14-19(17,18)13-11-16(3)15-12(13)2/h11,14H,4-10H2,1-3H3 |
| InChIKey | YGFKBZXQCNODSD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|