C17H16FN3O3S — CID 16676255
N-[4-(4-fluorophenoxy)phenyl]-1,3-dimethylpyrazole-4-sulfonamide (PubChem CID 16676255) has the molecular formula C17H16FN3O3S and a molecular weight of 361.40 g/mol. Its IUPAC name is N-[4-(4-fluorophenoxy)phenyl]-1,3-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-[4-(4-fluorophenoxy)phenyl]-1,3-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 16676255 |
| Molecular Formula | C17H16FN3O3S |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | N-[4-(4-fluorophenoxy)phenyl]-1,3-dimethylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)cc1S(=O)(=O)Nc1ccc(Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H16FN3O3S/c1-12-17(11-21(2)19-12)25(22,23)20-14-5-9-16(10-6-14)24-15-7-3-13(18)4-8-15/h3-11,20H,1-2H3 |
| InChIKey | DMCCALBLDRAPBP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |