C11H14N4O4S2 — CID 22774819
1,3-dimethyl-N-(4-sulfamoylphenyl)pyrazole-4-sulfonamide (PubChem CID 22774819) has the molecular formula C11H14N4O4S2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 1,3-dimethyl-N-(4-sulfamoylphenyl)pyrazole-4-sulfonamide.
| Compound Name | 1,3-dimethyl-N-(4-sulfamoylphenyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 22774819 |
| Molecular Formula | C11H14N4O4S2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 1,3-dimethyl-N-(4-sulfamoylphenyl)pyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)cc1S(=O)(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H14N4O4S2/c1-8-11(7-15(2)13-8)21(18,19)14-9-3-5-10(6-4-9)20(12,16)17/h3-7,14H,1-2H3,(H2,12,16,17) |
| InChIKey | RXHQEWSVHLIFNA-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |