C21H28N4O4S2 — CID 22202889
N-[4-(1-adamantylsulfamoyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide (PubChem CID 22202889) has the molecular formula C21H28N4O4S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-[4-(1-adamantylsulfamoyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-[4-(1-adamantylsulfamoyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 22202889 |
| Molecular Formula | C21H28N4O4S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | N-[4-(1-adamantylsulfamoyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)cc1S(=O)(=O)Nc1ccc(S(=O)(=O)NC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C21H28N4O4S2/c1-14-20(13-25(2)22-14)31(28,29)23-18-3-5-19(6-4-18)30(26,27)24-21-10-15-7-16(11-21)9-17(8-15)12-21/h3-6,13,15-17,23-24H,7-12H2,1-2H3 |
| InChIKey | RXPMSYJDGQEAEO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |