C15H22N4O4S2 — CID 17383073
N-[4-(tert-butylsulfamoyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide (PubChem CID 17383073) has the molecular formula C15H22N4O4S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-[4-(tert-butylsulfamoyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-[4-(tert-butylsulfamoyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 17383073 |
| Molecular Formula | C15H22N4O4S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N-[4-(tert-butylsulfamoyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)cc1S(=O)(=O)Nc1ccc(S(=O)(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H22N4O4S2/c1-11-14(10-19(5)16-11)25(22,23)17-12-6-8-13(9-7-12)24(20,21)18-15(2,3)4/h6-10,17-18H,1-5H3 |
| InChIKey | LGUSMMIEEGUOOG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |