C18H22N6O4S2 — CID 42283696
3-tert-butyl-1-methyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]pyrazole-4-sulfonamide (PubChem CID 42283696) has the molecular formula C18H22N6O4S2 and a molecular weight of 450.55 g/mol. Its IUPAC name is 3-tert-butyl-1-methyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]pyrazole-4-sulfonamide.
| Compound Name | 3-tert-butyl-1-methyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42283696 |
| Molecular Formula | C18H22N6O4S2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 3-tert-butyl-1-methyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]pyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3ncccn3)cc2)c(C(C)(C)C)n1 |
| InChI | InChI=1S/C18H22N6O4S2/c1-18(2,3)16-15(12-24(4)21-16)30(27,28)22-13-6-8-14(9-7-13)29(25,26)23-17-19-10-5-11-20-17/h5-12,22H,1-4H3,(H,19,20,23) |
| InChIKey | VBRLFDSFLRBTGX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |