C16H22N4O5S2 — CID 42283697
N-[4-[(3-tert-butyl-1-methylpyrazol-4-yl)sulfonylamino]phenyl]sulfonylacetamide (PubChem CID 42283697) has the molecular formula C16H22N4O5S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[4-[(3-tert-butyl-1-methylpyrazol-4-yl)sulfonylamino]phenyl]sulfonylacetamide.
| Compound Name | N-[4-[(3-tert-butyl-1-methylpyrazol-4-yl)sulfonylamino]phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 42283697 |
| Molecular Formula | C16H22N4O5S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-[4-[(3-tert-butyl-1-methylpyrazol-4-yl)sulfonylamino]phenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NS(=O)(=O)c2cn(C)nc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H22N4O5S2/c1-11(21)18-26(22,23)13-8-6-12(7-9-13)19-27(24,25)14-10-20(5)17-15(14)16(2,3)4/h6-10,19H,1-5H3,(H,18,21) |
| InChIKey | GHBWKUWIFPVDKA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |