C18H25N3O3S — CID 42284183
3-tert-butyl-1-cyclopentyl-N-(4-hydroxyphenyl)pyrazole-4-sulfonamide (PubChem CID 42284183) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is 3-tert-butyl-1-cyclopentyl-N-(4-hydroxyphenyl)pyrazole-4-sulfonamide.
| Compound Name | 3-tert-butyl-1-cyclopentyl-N-(4-hydroxyphenyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42284183 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 3-tert-butyl-1-cyclopentyl-N-(4-hydroxyphenyl)pyrazole-4-sulfonamide |
| SMILES | CC(C)(C)c1nn(C2CCCC2)cc1S(=O)(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C18H25N3O3S/c1-18(2,3)17-16(12-21(19-17)14-6-4-5-7-14)25(23,24)20-13-8-10-15(22)11-9-13/h8-12,14,20,22H,4-7H2,1-3H3 |
| InChIKey | UUYGRSOAMKVUCT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|