C20H29N3O2S — CID 42284167
3-tert-butyl-1-cyclopentyl-N-(2-ethylphenyl)pyrazole-4-sulfonamide (PubChem CID 42284167) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is 3-tert-butyl-1-cyclopentyl-N-(2-ethylphenyl)pyrazole-4-sulfonamide.
| Compound Name | 3-tert-butyl-1-cyclopentyl-N-(2-ethylphenyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42284167 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 3-tert-butyl-1-cyclopentyl-N-(2-ethylphenyl)pyrazole-4-sulfonamide |
| SMILES | CCc1ccccc1NS(=O)(=O)c1cn(C2CCCC2)nc1C(C)(C)C |
| InChI | InChI=1S/C20H29N3O2S/c1-5-15-10-6-9-13-17(15)22-26(24,25)18-14-23(16-11-7-8-12-16)21-19(18)20(2,3)4/h6,9-10,13-14,16,22H,5,7-8,11-12H2,1-4H3 |
| InChIKey | RDPDUFXVYNIAQI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |