C16H29N3O2S — CID 42284077
N,3-ditert-butyl-1-cyclopentylpyrazole-4-sulfonamide (PubChem CID 42284077) has the molecular formula C16H29N3O2S and a molecular weight of 327.49 g/mol. Its IUPAC name is N,3-ditert-butyl-1-cyclopentylpyrazole-4-sulfonamide.
| Compound Name | N,3-ditert-butyl-1-cyclopentylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42284077 |
| Molecular Formula | C16H29N3O2S |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | N,3-ditert-butyl-1-cyclopentylpyrazole-4-sulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cn(C2CCCC2)nc1C(C)(C)C |
| InChI | InChI=1S/C16H29N3O2S/c1-15(2,3)14-13(22(20,21)18-16(4,5)6)11-19(17-14)12-9-7-8-10-12/h11-12,18H,7-10H2,1-6H3 |
| InChIKey | UOEOPBZKAUCUKU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |