C15H22N4O3S — CID 42284241
3-tert-butyl-1-cyclopentyl-N-(1,2-oxazol-3-yl)pyrazole-4-sulfonamide (PubChem CID 42284241) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is 3-tert-butyl-1-cyclopentyl-N-(1,2-oxazol-3-yl)pyrazole-4-sulfonamide.
| Compound Name | 3-tert-butyl-1-cyclopentyl-N-(1,2-oxazol-3-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42284241 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 3-tert-butyl-1-cyclopentyl-N-(1,2-oxazol-3-yl)pyrazole-4-sulfonamide |
| SMILES | CC(C)(C)c1nn(C2CCCC2)cc1S(=O)(=O)Nc1ccon1 |
| InChI | InChI=1S/C15H22N4O3S/c1-15(2,3)14-12(10-19(16-14)11-6-4-5-7-11)23(20,21)18-13-8-9-22-17-13/h8-11H,4-7H2,1-3H3,(H,17,18) |
| InChIKey | POTCPQWLBQKUOI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |