C17H22N4O5S2 — CID 42282842
N-[4-[(1-cyclopentyl-3-methylpyrazol-4-yl)sulfonylamino]phenyl]sulfonylacetamide (PubChem CID 42282842) has the molecular formula C17H22N4O5S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[4-[(1-cyclopentyl-3-methylpyrazol-4-yl)sulfonylamino]phenyl]sulfonylacetamide.
| Compound Name | N-[4-[(1-cyclopentyl-3-methylpyrazol-4-yl)sulfonylamino]phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 42282842 |
| Molecular Formula | C17H22N4O5S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | N-[4-[(1-cyclopentyl-3-methylpyrazol-4-yl)sulfonylamino]phenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NS(=O)(=O)c2cn(C3CCCC3)nc2C)cc1 |
| InChI | InChI=1S/C17H22N4O5S2/c1-12-17(11-21(18-12)15-5-3-4-6-15)28(25,26)20-14-7-9-16(10-8-14)27(23,24)19-13(2)22/h7-11,15,20H,3-6H2,1-2H3,(H,19,22) |
| InChIKey | VTKWYLLKZKFZNY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |