C18H16N2O5S2 — CID 10501408
N-[4-(naphthalen-1-ylsulfonylamino)phenyl]sulfonylacetamide (PubChem CID 10501408) has the molecular formula C18H16N2O5S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[4-(naphthalen-1-ylsulfonylamino)phenyl]sulfonylacetamide.
| Compound Name | N-[4-(naphthalen-1-ylsulfonylamino)phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 10501408 |
| Molecular Formula | C18H16N2O5S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | N-[4-(naphthalen-1-ylsulfonylamino)phenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NS(=O)(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C18H16N2O5S2/c1-13(21)19-26(22,23)16-11-9-15(10-12-16)20-27(24,25)18-8-4-6-14-5-2-3-7-17(14)18/h2-12,20H,1H3,(H,19,21) |
| InChIKey | DZUXBBSOXGGPDY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |