C16H15N3O6S2 — CID 90624464
N-[4-(1,2-benzoxazol-3-ylmethylsulfonylamino)phenyl]sulfonylacetamide (PubChem CID 90624464) has the molecular formula C16H15N3O6S2 and a molecular weight of 409.45 g/mol. Its IUPAC name is N-[4-(1,2-benzoxazol-3-ylmethylsulfonylamino)phenyl]sulfonylacetamide.
| Compound Name | N-[4-(1,2-benzoxazol-3-ylmethylsulfonylamino)phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 90624464 |
| Molecular Formula | C16H15N3O6S2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | N-[4-(1,2-benzoxazol-3-ylmethylsulfonylamino)phenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NS(=O)(=O)Cc2noc3ccccc23)cc1 |
| InChI | InChI=1S/C16H15N3O6S2/c1-11(20)18-27(23,24)13-8-6-12(7-9-13)19-26(21,22)10-15-14-4-2-3-5-16(14)25-17-15/h2-9,19H,10H2,1H3,(H,18,20) |
| InChIKey | GWNHDHXQGOJFCF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |