C9H9N3O4S — CID 12507017
1,2-benzoxazol-3-ylmethylsulfonylurea (PubChem CID 12507017) has the molecular formula C9H9N3O4S and a molecular weight of 255.25 g/mol. Its IUPAC name is 1,2-benzoxazol-3-ylmethylsulfonylurea.
| Compound Name | 1,2-benzoxazol-3-ylmethylsulfonylurea |
|---|---|
| PubChem CID | 12507017 |
| Molecular Formula | C9H9N3O4S |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 1,2-benzoxazol-3-ylmethylsulfonylurea |
| SMILES | NC(=O)NS(=O)(=O)Cc1noc2ccccc12 |
| InChI | InChI=1S/C9H9N3O4S/c10-9(13)12-17(14,15)5-7-6-3-1-2-4-8(6)16-11-7/h1-4H,5H2,(H3,10,12,13) |
| InChIKey | FVLAWDUYGZGJME-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |