C16H14N2O4S — CID 72719846
N-(3-acetylphenyl)-1-(1,2-benzoxazol-3-yl)methanesulfonamide (PubChem CID 72719846) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is N-(3-acetylphenyl)-1-(1,2-benzoxazol-3-yl)methanesulfonamide.
| Compound Name | N-(3-acetylphenyl)-1-(1,2-benzoxazol-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 72719846 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N-(3-acetylphenyl)-1-(1,2-benzoxazol-3-yl)methanesulfonamide |
| SMILES | CC(=O)c1cccc(NS(=O)(=O)Cc2noc3ccccc23)c1 |
| InChI | InChI=1S/C16H14N2O4S/c1-11(19)12-5-4-6-13(9-12)18-23(20,21)10-15-14-7-2-3-8-16(14)22-17-15/h2-9,18H,10H2,1H3 |
| InChIKey | TZOGLRQUNPFFFU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |