C14H12N2O4S — CID 90624474
1-(1,2-benzoxazol-3-yl)-N-(3-hydroxyphenyl)methanesulfonamide (PubChem CID 90624474) has the molecular formula C14H12N2O4S and a molecular weight of 304.33 g/mol. Its IUPAC name is 1-(1,2-benzoxazol-3-yl)-N-(3-hydroxyphenyl)methanesulfonamide.
| Compound Name | 1-(1,2-benzoxazol-3-yl)-N-(3-hydroxyphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 90624474 |
| Molecular Formula | C14H12N2O4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-(1,2-benzoxazol-3-yl)-N-(3-hydroxyphenyl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1noc2ccccc12)Nc1cccc(O)c1 |
| InChI | InChI=1S/C14H12N2O4S/c17-11-5-3-4-10(8-11)16-21(18,19)9-13-12-6-1-2-7-14(12)20-15-13/h1-8,16-17H,9H2 |
| InChIKey | PJJVWECOPMEXBX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |