C16H16N2O5S — CID 90624516
1-(1,2-benzoxazol-3-yl)-N-(3,5-dimethoxyphenyl)methanesulfonamide (PubChem CID 90624516) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is 1-(1,2-benzoxazol-3-yl)-N-(3,5-dimethoxyphenyl)methanesulfonamide.
| Compound Name | 1-(1,2-benzoxazol-3-yl)-N-(3,5-dimethoxyphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 90624516 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 1-(1,2-benzoxazol-3-yl)-N-(3,5-dimethoxyphenyl)methanesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)Cc2noc3ccccc23)cc(OC)c1 |
| InChI | InChI=1S/C16H16N2O5S/c1-21-12-7-11(8-13(9-12)22-2)18-24(19,20)10-15-14-5-3-4-6-16(14)23-17-15/h3-9,18H,10H2,1-2H3 |
| InChIKey | XYXCWOUCCQJTCQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |