C15H14N2O5S2 — CID 90624669
1-(1,2-benzoxazol-3-yl)-N-(4-methylsulfonylphenyl)methanesulfonamide (PubChem CID 90624669) has the molecular formula C15H14N2O5S2 and a molecular weight of 366.42 g/mol. Its IUPAC name is 1-(1,2-benzoxazol-3-yl)-N-(4-methylsulfonylphenyl)methanesulfonamide.
| Compound Name | 1-(1,2-benzoxazol-3-yl)-N-(4-methylsulfonylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 90624669 |
| Molecular Formula | C15H14N2O5S2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 1-(1,2-benzoxazol-3-yl)-N-(4-methylsulfonylphenyl)methanesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(NS(=O)(=O)Cc2noc3ccccc23)cc1 |
| InChI | InChI=1S/C15H14N2O5S2/c1-23(18,19)12-8-6-11(7-9-12)17-24(20,21)10-14-13-4-2-3-5-15(13)22-16-14/h2-9,17H,10H2,1H3 |
| InChIKey | NAPIVOVFQDWUAX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |