C15H12N2O4S — CID 25122234
N-(benzenesulfonyl)-2-(1,2-benzoxazol-3-yl)acetamide (PubChem CID 25122234) has the molecular formula C15H12N2O4S and a molecular weight of 316.34 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2-(1,2-benzoxazol-3-yl)acetamide.
| Compound Name | N-(benzenesulfonyl)-2-(1,2-benzoxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 25122234 |
| Molecular Formula | C15H12N2O4S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | N-(benzenesulfonyl)-2-(1,2-benzoxazol-3-yl)acetamide |
| SMILES | O=C(Cc1noc2ccccc12)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H12N2O4S/c18-15(17-22(19,20)11-6-2-1-3-7-11)10-13-12-8-4-5-9-14(12)21-16-13/h1-9H,10H2,(H,17,18) |
| InChIKey | ABMBECGPVCLNNA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |