C21H17N3O2 — CID 47009947
2-(1,2-benzoxazol-3-yl)-N',N'-diphenylacetohydrazide (PubChem CID 47009947) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)-N',N'-diphenylacetohydrazide.
| Compound Name | 2-(1,2-benzoxazol-3-yl)-N',N'-diphenylacetohydrazide |
|---|---|
| PubChem CID | 47009947 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)-N',N'-diphenylacetohydrazide |
| SMILES | O=C(Cc1noc2ccccc12)NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17N3O2/c25-21(15-19-18-13-7-8-14-20(18)26-23-19)22-24(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14H,15H2,(H,22,25) |
| InChIKey | NPYXAYWMYABREJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|