C18H19N3O2 — CID 9183197
2-(1,2-benzoxazol-3-yl)-N'-ethyl-N'-(4-methylphenyl)acetohydrazide (PubChem CID 9183197) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)-N'-ethyl-N'-(4-methylphenyl)acetohydrazide.
| Compound Name | 2-(1,2-benzoxazol-3-yl)-N'-ethyl-N'-(4-methylphenyl)acetohydrazide |
|---|---|
| PubChem CID | 9183197 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)-N'-ethyl-N'-(4-methylphenyl)acetohydrazide |
| SMILES | CCN(NC(=O)Cc1noc2ccccc12)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H19N3O2/c1-3-21(14-10-8-13(2)9-11-14)19-18(22)12-16-15-6-4-5-7-17(15)23-20-16/h4-11H,3,12H2,1-2H3,(H,19,22) |
| InChIKey | DQOLBYPSPSGGNU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|